About 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole
4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole (PubChem CID 56894465) has the molecular formula C18H22N6
and a molecular weight of 322.42 g/mol. Its IUPAC name is 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole.
Molecular Properties
| Compound Name | 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole |
| PubChem CID | 56894465 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole |
| SMILES | Cc1cc(C)n(C2CCN(Cc3cn(-c4ccccc4)nn3)C2)n1 |
| InChI | InChI=1S/C18H22N6/c1-14-10-15(2)24(20-14)18-8-9-22(13-18)11-16-12-23(21-19-16)17-6-4-3-5-7-17/h3-7,10,12,18H,8-9,11,13H2,1-2H3 |
| InChIKey | LFTJXGHDDZSABE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole?
The IUPAC name of 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole (CID 56894465) is 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole.
What is the SMILES notation for 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole?
The canonical SMILES for 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole is Cc1cc(C)n(C2CCN(Cc3cn(-c4ccccc4)nn3)C2)n1.
What is the InChIKey of 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole?
The InChIKey is LFTJXGHDDZSABE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N6/c1-14-10-15(2)24(20-14)18-8-9-22(13-18)11-16-12-23(21-19-16)17-6-4-3-5-7-17/h3-7,10,12,18H,8-9,11,13H2,1-2H3.
What are the key properties of 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole?
4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole has a molecular weight of 322.42 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]methyl]-1-phenyltriazole is sourced from PubChem (CID 56894465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).