About 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine
4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine (PubChem CID 56894471) has the molecular formula C17H33N3O
and a molecular weight of 295.47 g/mol. Its IUPAC name is 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine.
Molecular Properties
| Compound Name | 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine |
| PubChem CID | 56894471 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine |
| SMILES | CC(C)(CN1CCC2(CCNCC2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C17H33N3O/c1-16(2,20-11-13-21-14-12-20)15-19-9-5-17(6-10-19)3-7-18-8-4-17/h18H,3-15H2,1-2H3 |
| InChIKey | FEGNYLKNUMYQPK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine?
The IUPAC name of 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine (CID 56894471) is 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine.
What is the SMILES notation for 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine?
The canonical SMILES for 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine is CC(C)(CN1CCC2(CCNCC2)CC1)N1CCOCC1.
What is the InChIKey of 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine?
The InChIKey is FEGNYLKNUMYQPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N3O/c1-16(2,20-11-13-21-14-12-20)15-19-9-5-17(6-10-19)3-7-18-8-4-17/h18H,3-15H2,1-2H3.
What are the key properties of 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine?
4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine has a molecular weight of 295.47 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methylpropan-2-yl]morpholine is sourced from PubChem (CID 56894471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).