C19H21F2N3S — CID 56894537
2-[[(2R,3R,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methyl]-1,3-thiazole (PubChem CID 56894537) has the molecular formula C19H21F2N3S and a molecular weight of 361.46 g/mol. Its IUPAC name is 2-[[(2R,3R,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(2R,3R,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 56894537 |
| Molecular Formula | C19H21F2N3S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2-[[(2R,3R,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methyl]-1,3-thiazole |
| SMILES | Fc1cc(F)cc([C@@H]2CN(Cc3nccs3)[C@@H]3C4CCN(CC4)[C@@H]32)c1 |
| InChI | InChI=1S/C19H21F2N3S/c20-14-7-13(8-15(21)9-14)16-10-24(11-17-22-3-6-25-17)18-12-1-4-23(5-2-12)19(16)18/h3,6-9,12,16,18-19H,1-2,4-5,10-11H2/t16-,18+,19+/m0/s1 |
| InChIKey | NFXZGRKXPZVVHX-QXAKKESOSA-N |
| XLogP | 3.48 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |