C19H20N4O4 — CID 56894607
3-[3-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]morpholine-4-carbonyl]-1H-quinoxalin-2-one (PubChem CID 56894607) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-[3-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]morpholine-4-carbonyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[3-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]morpholine-4-carbonyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 56894607 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-[3-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]morpholine-4-carbonyl]-1H-quinoxalin-2-one |
| SMILES | O=C(CC1COCCN1C(=O)c1nc2ccccc2[nH]c1=O)N1CC=CC1 |
| InChI | InChI=1S/C19H20N4O4/c24-16(22-7-3-4-8-22)11-13-12-27-10-9-23(13)19(26)17-18(25)21-15-6-2-1-5-14(15)20-17/h1-6,13H,7-12H2,(H,21,25) |
| InChIKey | UPKYUUGKZRSHNB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|