C17H27N5O3 — CID 56894681
(4aS,8aR)-1-(3-methoxypropyl)-6-[3-(1,2,4-triazol-1-yl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56894681) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-methoxypropyl)-6-[3-(1,2,4-triazol-1-yl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-methoxypropyl)-6-[3-(1,2,4-triazol-1-yl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56894681 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | (4aS,8aR)-1-(3-methoxypropyl)-6-[3-(1,2,4-triazol-1-yl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | COCCCN1C(=O)CC[C@H]2CN(C(=O)CCn3cncn3)CC[C@H]21 |
| InChI | InChI=1S/C17H27N5O3/c1-25-10-2-7-22-15-5-8-20(11-14(15)3-4-17(22)24)16(23)6-9-21-13-18-12-19-21/h12-15H,2-11H2,1H3/t14-,15+/m0/s1 |
| InChIKey | YQEWIXXKCNRKNB-LSDHHAIUSA-N |
| XLogP | 0.54 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|