C14H21N5O — CID 56894712
1-[3-[(2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one (PubChem CID 56894712) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-[3-[(2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 56894712 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-[3-[(2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one |
| SMILES | Cc1nc2c(c(NCCCN3CCCC3=O)n1)CNC2 |
| InChI | InChI=1S/C14H21N5O/c1-10-17-12-9-15-8-11(12)14(18-10)16-5-3-7-19-6-2-4-13(19)20/h15H,2-9H2,1H3,(H,16,17,18) |
| InChIKey | CFNJLXLFTRNAPK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|