C17H25N3O4 — CID 56894840
N-[(3-hydroxypyrrolidin-3-yl)methyl]-4-methoxy-3-morpholin-4-ylbenzamide (PubChem CID 56894840) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[(3-hydroxypyrrolidin-3-yl)methyl]-4-methoxy-3-morpholin-4-ylbenzamide.
| Compound Name | N-[(3-hydroxypyrrolidin-3-yl)methyl]-4-methoxy-3-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 56894840 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[(3-hydroxypyrrolidin-3-yl)methyl]-4-methoxy-3-morpholin-4-ylbenzamide |
| SMILES | COc1ccc(C(=O)NCC2(O)CCNC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C17H25N3O4/c1-23-15-3-2-13(10-14(15)20-6-8-24-9-7-20)16(21)19-12-17(22)4-5-18-11-17/h2-3,10,18,22H,4-9,11-12H2,1H3,(H,19,21) |
| InChIKey | KKSIWEDFDBHVDC-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |