C19H26N2O4 — CID 56894986
6-O-benzyl 4a-O-ethyl (4aS,8aR)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a,6-dicarboxylate (PubChem CID 56894986) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 6-O-benzyl 4a-O-ethyl (4aS,8aR)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a,6-dicarboxylate.
| Compound Name | 6-O-benzyl 4a-O-ethyl (4aS,8aR)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a,6-dicarboxylate |
|---|---|
| PubChem CID | 56894986 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 6-O-benzyl 4a-O-ethyl (4aS,8aR)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a,6-dicarboxylate |
| SMILES | CCOC(=O)[C@]12CCCN[C@@H]1CCN(C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C19H26N2O4/c1-2-24-17(22)19-10-6-11-20-16(19)9-12-21(14-19)18(23)25-13-15-7-4-3-5-8-15/h3-5,7-8,16,20H,2,6,9-14H2,1H3/t16-,19+/m1/s1 |
| InChIKey | BBXUHOFHTPZXJS-APWZRJJASA-N |
| XLogP | 2.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |