C18H27N5O — CID 56895371
N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-ethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine (PubChem CID 56895371) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-ethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine.
| Compound Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-ethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 56895371 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-ethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
| SMILES | CCc1nc2c(c(NCCCc3c(C)noc3C)n1)CCNCC2 |
| InChI | InChI=1S/C18H27N5O/c1-4-17-21-16-8-11-19-10-7-15(16)18(22-17)20-9-5-6-14-12(2)23-24-13(14)3/h19H,4-11H2,1-3H3,(H,20,21,22) |
| InChIKey | CIJRMAHSXFDGAX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|