C14H20N6O2 — CID 56895551
N-[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine (PubChem CID 56895551) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine.
| Compound Name | N-[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 56895551 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
| SMILES | COCc1noc(CCNc2ncnc3c2CCNCC3)n1 |
| InChI | InChI=1S/C14H20N6O2/c1-21-8-12-19-13(22-20-12)4-7-16-14-10-2-5-15-6-3-11(10)17-9-18-14/h9,15H,2-8H2,1H3,(H,16,17,18) |
| InChIKey | WCYUGSSTARAJGE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |