C19H24N4O3 — CID 56895658
5-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 56895658) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 5-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 5-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 56895658 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 5-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | CCCN1C(=O)CC[C@H]2CN(C(=O)c3cc(C#N)c(=O)[nH]c3C)CC[C@H]21 |
| InChI | InChI=1S/C19H24N4O3/c1-3-7-23-16-6-8-22(11-13(16)4-5-17(23)24)19(26)15-9-14(10-20)18(25)21-12(15)2/h9,13,16H,3-8,11H2,1-2H3,(H,21,25)/t13-,16+/m0/s1 |
| InChIKey | YARFXBGYMKIHAX-XJKSGUPXSA-N |
| XLogP | 1.42 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |