C12H15N — CID 568957
7-phenyl-3,4,5,6-tetrahydro-2H-azepine (PubChem CID 568957) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 7-phenyl-3,4,5,6-tetrahydro-2H-azepine.
| Compound Name | 7-phenyl-3,4,5,6-tetrahydro-2H-azepine |
|---|---|
| PubChem CID | 568957 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 7-phenyl-3,4,5,6-tetrahydro-2H-azepine |
| SMILES | c1ccc(C2=NCCCCC2)cc1 |
| InChI | InChI=1S/C12H15N/c1-3-7-11(8-4-1)12-9-5-2-6-10-13-12/h1,3-4,7-8H,2,5-6,9-10H2 |
| InChIKey | PGRRLZTVOUMEAO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |