About 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one
1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 56895980) has the molecular formula C21H19N3O3
and a molecular weight of 361.40 g/mol. Its IUPAC name is 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one |
| PubChem CID | 56895980 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | O=C(Cc1noc2ccccc12)N1CCC2(CC1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C21H19N3O3/c25-19(13-17-14-5-1-4-8-18(14)27-23-17)24-11-9-21(10-12-24)15-6-2-3-7-16(15)22-20(21)26/h1-8H,9-13H2,(H,22,26) |
| InChIKey | PCRKWIAZGFHSHE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one?
The IUPAC name of 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one (CID 56895980) is 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one.
What is the SMILES notation for 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one?
The canonical SMILES for 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one is O=C(Cc1noc2ccccc12)N1CCC2(CC1)C(=O)Nc1ccccc12.
What is the InChIKey of 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one?
The InChIKey is PCRKWIAZGFHSHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O3/c25-19(13-17-14-5-1-4-8-18(14)27-23-17)24-11-9-21(10-12-24)15-6-2-3-7-16(15)22-20(21)26/h1-8H,9-13H2,(H,22,26).
What are the key properties of 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one?
1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one has a molecular weight of 361.40 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[2-(1,2-benzoxazol-3-yl)acetyl]spiro[1H-indole-3,4'-piperidine]-2-one is sourced from PubChem (CID 56895980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).