About 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine
4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine (PubChem CID 56896230) has the molecular formula C17H20F2N4
and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine |
| PubChem CID | 56896230 |
| Molecular Formula | C17H20F2N4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(N2CCCC(CCc3ccc(F)cc3F)C2)n1 |
| InChI | InChI=1S/C17H20F2N4/c18-14-6-5-13(15(19)10-14)4-3-12-2-1-9-23(11-12)16-7-8-21-17(20)22-16/h5-8,10,12H,1-4,9,11H2,(H2,20,21,22) |
| InChIKey | NMKDIFKCDMKUMZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine?
The IUPAC name of 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine (CID 56896230) is 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine.
What is the SMILES notation for 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine?
The canonical SMILES for 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine is Nc1nccc(N2CCCC(CCc3ccc(F)cc3F)C2)n1.
What is the InChIKey of 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine?
The InChIKey is NMKDIFKCDMKUMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F2N4/c18-14-6-5-13(15(19)10-14)4-3-12-2-1-9-23(11-12)16-7-8-21-17(20)22-16/h5-8,10,12H,1-4,9,11H2,(H2,20,21,22).
What are the key properties of 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine?
4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine has a molecular weight of 318.37 g/mol, XLogP of 3.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]pyrimidin-2-amine is sourced from PubChem (CID 56896230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).