C16H25N7O — CID 56896361
2-(ethoxymethyl)-N-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine (PubChem CID 56896361) has the molecular formula C16H25N7O and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-(ethoxymethyl)-N-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine.
| Compound Name | 2-(ethoxymethyl)-N-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 56896361 |
| Molecular Formula | C16H25N7O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 2-(ethoxymethyl)-N-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
| SMILES | CCOCc1nc2c(c(NC(C)c3n[nH]c(C)n3)n1)CCNCC2 |
| InChI | InChI=1S/C16H25N7O/c1-4-24-9-14-20-13-6-8-17-7-5-12(13)16(21-14)18-10(2)15-19-11(3)22-23-15/h10,17H,4-9H2,1-3H3,(H,18,20,21)(H,19,22,23) |
| InChIKey | YBPYBYBRFPTCGD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |