C20H19N5 — CID 56896484
2-[(1-phenyltriazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 56896484) has the molecular formula C20H19N5 and a molecular weight of 329.41 g/mol. Its IUPAC name is 2-[(1-phenyltriazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[(1-phenyltriazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 56896484 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[(1-phenyltriazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | c1ccc(-n2cc(CN3CCc4c([nH]c5ccccc45)C3)nn2)cc1 |
| InChI | InChI=1S/C20H19N5/c1-2-6-16(7-3-1)25-13-15(22-23-25)12-24-11-10-18-17-8-4-5-9-19(17)21-20(18)14-24/h1-9,13,21H,10-12,14H2 |
| InChIKey | ITWKMNNEXOVUKO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|