C18H21N7O — CID 56896842
4-N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56896842) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56896842 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 4-N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | Cc1ccc(-c2noc(CNc3nc(N)nc4c3CCNCC4)n2)cc1 |
| InChI | InChI=1S/C18H21N7O/c1-11-2-4-12(5-3-11)16-23-15(26-25-16)10-21-17-13-6-8-20-9-7-14(13)22-18(19)24-17/h2-5,20H,6-10H2,1H3,(H3,19,21,22,24) |
| InChIKey | KLNPPRCVJULRLT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |