About 2-phenylazetidine
2-phenylazetidine (PubChem CID 568971) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-phenylazetidine.
Molecular Properties
| Compound Name | 2-phenylazetidine |
| PubChem CID | 568971 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 2-phenylazetidine |
| SMILES | c1ccc(C2CCN2)cc1 |
| InChI | InChI=1S/C9H11N/c1-2-4-8(5-3-1)9-6-7-10-9/h1-5,9-10H,6-7H2 |
| InChIKey | CLNGGMJEJSANIE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylazetidine?
The IUPAC name of 2-phenylazetidine (CID 568971) is 2-phenylazetidine.
What is the SMILES notation for 2-phenylazetidine?
The canonical SMILES for 2-phenylazetidine is c1ccc(C2CCN2)cc1.
What is the InChIKey of 2-phenylazetidine?
The InChIKey is CLNGGMJEJSANIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N/c1-2-4-8(5-3-1)9-6-7-10-9/h1-5,9-10H,6-7H2.
What are the key properties of 2-phenylazetidine?
2-phenylazetidine has a molecular weight of 133.19 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylazetidine is sourced from PubChem (CID 568971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).