C18H31N5 — CID 56897788
N'-[2-(cyclopropylmethyl)-7-methyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-yl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 56897788) has the molecular formula C18H31N5 and a molecular weight of 317.48 g/mol. Its IUPAC name is N'-[2-(cyclopropylmethyl)-7-methyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-yl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[2-(cyclopropylmethyl)-7-methyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-yl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 56897788 |
| Molecular Formula | C18H31N5 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | N'-[2-(cyclopropylmethyl)-7-methyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-yl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)c1nc(CC2CC2)nc2c1CCN(C)CC2 |
| InChI | InChI=1S/C18H31N5/c1-21(2)11-12-23(4)18-15-7-9-22(3)10-8-16(15)19-17(20-18)13-14-5-6-14/h14H,5-13H2,1-4H3 |
| InChIKey | HGZVVRVZMQFNNX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |