C18H28N4O3 — CID 56898005
5-[3-[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-oxopropyl]-4,6-dimethyl-1H-pyrimidin-2-one (PubChem CID 56898005) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 5-[3-[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-oxopropyl]-4,6-dimethyl-1H-pyrimidin-2-one.
| Compound Name | 5-[3-[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-oxopropyl]-4,6-dimethyl-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 56898005 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 5-[3-[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-oxopropyl]-4,6-dimethyl-1H-pyrimidin-2-one |
| SMILES | Cc1nc(=O)[nH]c(C)c1CCC(=O)N1CC[C@H]2NCCC[C@]2(CO)C1 |
| InChI | InChI=1S/C18H28N4O3/c1-12-14(13(2)21-17(25)20-12)4-5-16(24)22-9-6-15-18(10-22,11-23)7-3-8-19-15/h15,19,23H,3-11H2,1-2H3,(H,20,21,25)/t15-,18-/m1/s1 |
| InChIKey | AEUGSGUWUGMHJO-CRAIPNDOSA-N |
| XLogP | 0.28 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |