C16H20N4O3 — CID 56898183
4-(4-methylpyrazol-1-yl)-1-(4-methyl-1H-pyrrole-2-carbonyl)piperidine-4-carboxylic acid (PubChem CID 56898183) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-(4-methylpyrazol-1-yl)-1-(4-methyl-1H-pyrrole-2-carbonyl)piperidine-4-carboxylic acid.
| Compound Name | 4-(4-methylpyrazol-1-yl)-1-(4-methyl-1H-pyrrole-2-carbonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56898183 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-(4-methylpyrazol-1-yl)-1-(4-methyl-1H-pyrrole-2-carbonyl)piperidine-4-carboxylic acid |
| SMILES | Cc1c[nH]c(C(=O)N2CCC(C(=O)O)(n3cc(C)cn3)CC2)c1 |
| InChI | InChI=1S/C16H20N4O3/c1-11-7-13(17-8-11)14(21)19-5-3-16(4-6-19,15(22)23)20-10-12(2)9-18-20/h7-10,17H,3-6H2,1-2H3,(H,22,23) |
| InChIKey | PQZMNGMNPCRTMJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |