About N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide
N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide (PubChem CID 56898587) has the molecular formula C20H32N4O3
and a molecular weight of 376.50 g/mol. Its IUPAC name is N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide |
| PubChem CID | 56898587 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide |
| SMILES | Cc1nn(C)c(C)c1CCC(=O)N1CCOCC1CC(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H32N4O3/c1-14-18(15(2)23(3)22-14)8-9-20(26)24-10-11-27-13-17(24)12-19(25)21-16-6-4-5-7-16/h16-17H,4-13H2,1-3H3,(H,21,25) |
| InChIKey | LCYRYHYWBPEFSB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide?
The IUPAC name of N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide (CID 56898587) is N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide.
What is the SMILES notation for N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide?
The canonical SMILES for N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide is Cc1nn(C)c(C)c1CCC(=O)N1CCOCC1CC(=O)NC1CCCC1.
What is the InChIKey of N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide?
The InChIKey is LCYRYHYWBPEFSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N4O3/c1-14-18(15(2)23(3)22-14)8-9-20(26)24-10-11-27-13-17(24)12-19(25)21-16-6-4-5-7-16/h16-17H,4-13H2,1-3H3,(H,21,25).
What are the key properties of N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide?
N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide has a molecular weight of 376.50 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-[4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]morpholin-3-yl]acetamide is sourced from PubChem (CID 56898587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).