C17H24N4O4 — CID 56899017
1-[2-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 56899017) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[2-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56899017 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[2-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | CCCN1C(=O)CC[C@H]2CN(C(=O)Cn3ccc(=O)[nH]c3=O)CC[C@H]21 |
| InChI | InChI=1S/C17H24N4O4/c1-2-7-21-13-5-8-19(10-12(13)3-4-15(21)23)16(24)11-20-9-6-14(22)18-17(20)25/h6,9,12-13H,2-5,7-8,10-11H2,1H3,(H,18,22,25)/t12-,13+/m0/s1 |
| InChIKey | BUJBUOCZKHVPTI-QWHCGFSZSA-N |
| XLogP | -0.21 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |