C17H31N5O — CID 56899449
[3-[2-(dimethylamino)ethyl-methylamino]piperidin-1-yl]-(2-propylpyrazol-3-yl)methanone (PubChem CID 56899449) has the molecular formula C17H31N5O and a molecular weight of 321.47 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl-methylamino]piperidin-1-yl]-(2-propylpyrazol-3-yl)methanone.
| Compound Name | [3-[2-(dimethylamino)ethyl-methylamino]piperidin-1-yl]-(2-propylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 56899449 |
| Molecular Formula | C17H31N5O |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl-methylamino]piperidin-1-yl]-(2-propylpyrazol-3-yl)methanone |
| SMILES | CCCn1nccc1C(=O)N1CCCC(N(C)CCN(C)C)C1 |
| InChI | InChI=1S/C17H31N5O/c1-5-10-22-16(8-9-18-22)17(23)21-11-6-7-15(14-21)20(4)13-12-19(2)3/h8-9,15H,5-7,10-14H2,1-4H3 |
| InChIKey | FZFYZXIXBWQERP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |