C15H23N3O — CID 56899477
3-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]pyridin-2-amine (PubChem CID 56899477) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]pyridin-2-amine.
| Compound Name | 3-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 56899477 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 3-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]pyridin-2-amine |
| SMILES | Nc1ncccc1OC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C15H23N3O/c16-15-14(7-3-8-17-15)19-11-12-5-4-10-18-9-2-1-6-13(12)18/h3,7-8,12-13H,1-2,4-6,9-11H2,(H2,16,17)/t12-,13+/m0/s1 |
| InChIKey | FRIYOIUFZFBGLP-QWHCGFSZSA-N |
| XLogP | 2.31 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |