About (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone
(6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 56899544) has the molecular formula C16H20ClN5O
and a molecular weight of 333.82 g/mol. Its IUPAC name is (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| PubChem CID | 56899544 |
| Molecular Formula | C16H20ClN5O |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cn2cc(Cl)cnc2n1)N1CCCC(N2CCCC2)C1 |
| InChI | InChI=1S/C16H20ClN5O/c17-12-8-18-16-19-14(11-22(16)9-12)15(23)21-7-3-4-13(10-21)20-5-1-2-6-20/h8-9,11,13H,1-7,10H2 |
| InChIKey | BUJYRIQXCSIWFS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone?
The IUPAC name of (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone (CID 56899544) is (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone.
What is the SMILES notation for (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone?
The canonical SMILES for (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone is O=C(c1cn2cc(Cl)cnc2n1)N1CCCC(N2CCCC2)C1.
What is the InChIKey of (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone?
The InChIKey is BUJYRIQXCSIWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN5O/c17-12-8-18-16-19-14(11-22(16)9-12)15(23)21-7-3-4-13(10-21)20-5-1-2-6-20/h8-9,11,13H,1-7,10H2.
What are the key properties of (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone?
(6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone has a molecular weight of 333.82 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloroimidazo[1,2-a]pyrimidin-2-yl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone is sourced from PubChem (CID 56899544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).