C22H37N3O — CID 56899599
(4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(1-methylpiperidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56899599) has the molecular formula C22H37N3O and a molecular weight of 359.56 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(1-methylpiperidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(1-methylpiperidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56899599 |
| Molecular Formula | C22H37N3O |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.29 |
| IUPAC Name | (4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(1-methylpiperidin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CN1CCC(N2CC[C@@H]3[C@@H](CCC(=O)N3CCC3=CCCCC3)C2)CC1 |
| InChI | InChI=1S/C22H37N3O/c1-23-13-10-20(11-14-23)24-15-12-21-19(17-24)7-8-22(26)25(21)16-9-18-5-3-2-4-6-18/h5,19-21H,2-4,6-17H2,1H3/t19-,21+/m0/s1 |
| InChIKey | SBBWEUJCLLHXAQ-PZJWPPBQSA-N |
| XLogP | 3.28 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|