C16H24N6OS — CID 56900070
2-N-(2-methoxyethyl)-4-N-methyl-4-N-(1,3-thiazol-2-ylmethyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56900070) has the molecular formula C16H24N6OS and a molecular weight of 348.48 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-4-N-methyl-4-N-(1,3-thiazol-2-ylmethyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 2-N-(2-methoxyethyl)-4-N-methyl-4-N-(1,3-thiazol-2-ylmethyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56900070 |
| Molecular Formula | C16H24N6OS |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-N-(2-methoxyethyl)-4-N-methyl-4-N-(1,3-thiazol-2-ylmethyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | COCCNc1nc2c(c(N(C)Cc3nccs3)n1)CCNCC2 |
| InChI | InChI=1S/C16H24N6OS/c1-22(11-14-18-8-10-24-14)15-12-3-5-17-6-4-13(12)20-16(21-15)19-7-9-23-2/h8,10,17H,3-7,9,11H2,1-2H3,(H,19,20,21) |
| InChIKey | ZYJRWWMPMQFZKY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|