About (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine
(3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine (PubChem CID 56900331) has the molecular formula C16H26N6
and a molecular weight of 302.43 g/mol. Its IUPAC name is (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine |
| PubChem CID | 56900331 |
| Molecular Formula | C16H26N6 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)[C@H]1CCN(c2nc(C(C)(C)C)nc3c2cnn3C)C1 |
| InChI | InChI=1S/C16H26N6/c1-16(2,3)15-18-13-12(9-17-21(13)6)14(19-15)22-8-7-11(10-22)20(4)5/h9,11H,7-8,10H2,1-6H3/t11-/m0/s1 |
| InChIKey | PDJJLJIAEOFPPF-NSHDSACASA-N |
| XLogP | 1.80 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine?
The IUPAC name of (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine (CID 56900331) is (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine.
What is the SMILES notation for (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine?
The canonical SMILES for (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine is CN(C)[C@H]1CCN(c2nc(C(C)(C)C)nc3c2cnn3C)C1.
What is the InChIKey of (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine?
The InChIKey is PDJJLJIAEOFPPF-NSHDSACASA-N. The full InChI is InChI=1S/C16H26N6/c1-16(2,3)15-18-13-12(9-17-21(13)6)14(19-15)22-8-7-11(10-22)20(4)5/h9,11H,7-8,10H2,1-6H3/t11-/m0/s1.
What are the key properties of (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine?
(3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine has a molecular weight of 302.43 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(6-tert-butyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine is sourced from PubChem (CID 56900331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).