C21H30N4O — CID 56900523
(4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(6-methylpyridazin-3-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56900523) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(6-methylpyridazin-3-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(6-methylpyridazin-3-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56900523 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (4aS,8aR)-1-[2-(cyclohexen-1-yl)ethyl]-6-(6-methylpyridazin-3-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | Cc1ccc(N2CC[C@@H]3[C@@H](CCC(=O)N3CCC3=CCCCC3)C2)nn1 |
| InChI | InChI=1S/C21H30N4O/c1-16-7-9-20(23-22-16)24-13-12-19-18(15-24)8-10-21(26)25(19)14-11-17-5-3-2-4-6-17/h5,7,9,18-19H,2-4,6,8,10-15H2,1H3/t18-,19+/m0/s1 |
| InChIKey | YPBXSDYWHOVHSA-RBUKOAKNSA-N |
| XLogP | 3.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|