About [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone
[4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 56900646) has the molecular formula C21H22FN3O2
and a molecular weight of 367.42 g/mol. Its IUPAC name is [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone |
| PubChem CID | 56900646 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cc(N2CC=C(c3ccc(F)cc3)CC2)ccn1)N1CCOCC1 |
| InChI | InChI=1S/C21H22FN3O2/c22-18-3-1-16(2-4-18)17-6-9-24(10-7-17)19-5-8-23-20(15-19)21(26)25-11-13-27-14-12-25/h1-6,8,15H,7,9-14H2 |
| InChIKey | LYHMQLBKKSEIEA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone?
The IUPAC name of [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone (CID 56900646) is [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone.
What is the SMILES notation for [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone?
The canonical SMILES for [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone is O=C(c1cc(N2CC=C(c3ccc(F)cc3)CC2)ccn1)N1CCOCC1.
What is the InChIKey of [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone?
The InChIKey is LYHMQLBKKSEIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN3O2/c22-18-3-1-16(2-4-18)17-6-9-24(10-7-17)19-5-8-23-20(15-19)21(26)25-11-13-27-14-12-25/h1-6,8,15H,7,9-14H2.
What are the key properties of [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone?
[4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone has a molecular weight of 367.42 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]-morpholin-4-ylmethanone is sourced from PubChem (CID 56900646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).