C19H25FN4 — CID 56900861
5-[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methyl]-2-propan-2-ylpyrimidine (PubChem CID 56900861) has the molecular formula C19H25FN4 and a molecular weight of 328.44 g/mol. Its IUPAC name is 5-[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methyl]-2-propan-2-ylpyrimidine.
| Compound Name | 5-[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methyl]-2-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 56900861 |
| Molecular Formula | C19H25FN4 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 5-[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methyl]-2-propan-2-ylpyrimidine |
| SMILES | CC(C)c1ncc(CN2CCN(Cc3cccc(F)c3)CC2)cn1 |
| InChI | InChI=1S/C19H25FN4/c1-15(2)19-21-11-17(12-22-19)14-24-8-6-23(7-9-24)13-16-4-3-5-18(20)10-16/h3-5,10-12,15H,6-9,13-14H2,1-2H3 |
| InChIKey | MYSQVVJCPNLASK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |