C21H21ClN2O3 — CID 56901095
2-[3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]-2-oxo-N-phenylacetamide (PubChem CID 56901095) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is 2-[3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]-2-oxo-N-phenylacetamide.
| Compound Name | 2-[3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]-2-oxo-N-phenylacetamide |
|---|---|
| PubChem CID | 56901095 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-[3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]-2-oxo-N-phenylacetamide |
| SMILES | Cc1cc(Cl)ccc1C(=O)C1CCCN(C(=O)C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C21H21ClN2O3/c1-14-12-16(22)9-10-18(14)19(25)15-6-5-11-24(13-15)21(27)20(26)23-17-7-3-2-4-8-17/h2-4,7-10,12,15H,5-6,11,13H2,1H3,(H,23,26) |
| InChIKey | MWDHQIVQGSHTQT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|