About 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol
3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 56901279) has the molecular formula C14H15N3OS
and a molecular weight of 273.36 g/mol. Its IUPAC name is 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol |
| PubChem CID | 56901279 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1csc(CN2CCn3cncc3C2)c1 |
| InChI | InChI=1S/C14H15N3OS/c18-5-1-2-12-6-14(19-10-12)9-16-3-4-17-11-15-7-13(17)8-16/h6-7,10-11,18H,3-5,8-9H2 |
| InChIKey | HUADPWNIXPNJFN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol?
The IUPAC name of 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol (CID 56901279) is 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol.
What is the SMILES notation for 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol?
The canonical SMILES for 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol is OCC#Cc1csc(CN2CCn3cncc3C2)c1.
What is the InChIKey of 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol?
The InChIKey is HUADPWNIXPNJFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3OS/c18-5-1-2-12-6-14(19-10-12)9-16-3-4-17-11-15-7-13(17)8-16/h6-7,10-11,18H,3-5,8-9H2.
What are the key properties of 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol?
3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol has a molecular weight of 273.36 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol is sourced from PubChem (CID 56901279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).