About 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine
4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine (PubChem CID 56901566) has the molecular formula C21H31N5O2
and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine |
| PubChem CID | 56901566 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine |
| SMILES | COc1ccc(CCN(C)C2CCCN(c3cc(C)nc(N)n3)C2)cc1OC |
| InChI | InChI=1S/C21H31N5O2/c1-15-12-20(24-21(22)23-15)26-10-5-6-17(14-26)25(2)11-9-16-7-8-18(27-3)19(13-16)28-4/h7-8,12-13,17H,5-6,9-11,14H2,1-4H3,(H2,22,23,24) |
| InChIKey | XZHRTXPNCSJEDG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine?
The IUPAC name of 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine (CID 56901566) is 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine.
What is the SMILES notation for 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine?
The canonical SMILES for 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine is COc1ccc(CCN(C)C2CCCN(c3cc(C)nc(N)n3)C2)cc1OC.
What is the InChIKey of 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine?
The InChIKey is XZHRTXPNCSJEDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N5O2/c1-15-12-20(24-21(22)23-15)26-10-5-6-17(14-26)25(2)11-9-16-7-8-18(27-3)19(13-16)28-4/h7-8,12-13,17H,5-6,9-11,14H2,1-4H3,(H2,22,23,24).
What are the key properties of 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine?
4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine has a molecular weight of 385.51 g/mol, XLogP of 2.53, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine is sourced from PubChem (CID 56901566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).