C19H31N5O — CID 56902545
(4aS,8aR)-1-(3-aminopropyl)-6-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56902545) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-aminopropyl)-6-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-aminopropyl)-6-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56902545 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | (4aS,8aR)-1-(3-aminopropyl)-6-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | Cn1ncc(CN2CC[C@@H]3[C@@H](CCC(=O)N3CCCN)C2)c1C1CC1 |
| InChI | InChI=1S/C19H31N5O/c1-22-19(14-3-4-14)16(11-21-22)13-23-10-7-17-15(12-23)5-6-18(25)24(17)9-2-8-20/h11,14-15,17H,2-10,12-13,20H2,1H3/t15-,17+/m0/s1 |
| InChIKey | ZRWMVZTVPGTGIR-DOTOQJQBSA-N |
| XLogP | 1.46 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |