C19H27N3O3 — CID 56902697
(4aS,8aR)-6-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56902697) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (4aS,8aR)-6-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56902697 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (4aS,8aR)-6-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCCN1C(=O)CC[C@H]2CN(C(=O)c3cc(C)c(C)[nH]c3=O)CC[C@H]21 |
| InChI | InChI=1S/C19H27N3O3/c1-4-8-22-16-7-9-21(11-14(16)5-6-17(22)23)19(25)15-10-12(2)13(3)20-18(15)24/h10,14,16H,4-9,11H2,1-3H3,(H,20,24)/t14-,16+/m0/s1 |
| InChIKey | RDEHOYRYRKSNFI-GOEBONIOSA-N |
| XLogP | 1.85 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |