C19H28N6 — CID 56902953
4-N-[3-(dimethylamino)-1-phenylpropyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56902953) has the molecular formula C19H28N6 and a molecular weight of 340.48 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)-1-phenylpropyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-[3-(dimethylamino)-1-phenylpropyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56902953 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 4-N-[3-(dimethylamino)-1-phenylpropyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | CN(C)CCC(Nc1nc(N)nc2c1CCNCC2)c1ccccc1 |
| InChI | InChI=1S/C19H28N6/c1-25(2)13-10-16(14-6-4-3-5-7-14)22-18-15-8-11-21-12-9-17(15)23-19(20)24-18/h3-7,16,21H,8-13H2,1-2H3,(H3,20,22,23,24) |
| InChIKey | QGLHFMSJOAXNBK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |