C23H29N3O3 — CID 56903301
N-[(1R,2R)-2-(2-methoxyethoxy)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-pyridin-3-ylacetamide (PubChem CID 56903301) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[(1R,2R)-2-(2-methoxyethoxy)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-pyridin-3-ylacetamide.
| Compound Name | N-[(1R,2R)-2-(2-methoxyethoxy)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 56903301 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[(1R,2R)-2-(2-methoxyethoxy)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-pyridin-3-ylacetamide |
| SMILES | COCCO[C@H]1[C@H](NC(=O)Cc2cccnc2)c2ccccc2C12CCNCC2 |
| InChI | InChI=1S/C23H29N3O3/c1-28-13-14-29-22-21(26-20(27)15-17-5-4-10-25-16-17)18-6-2-3-7-19(18)23(22)8-11-24-12-9-23/h2-7,10,16,21-22,24H,8-9,11-15H2,1H3,(H,26,27)/t21-,22+/m1/s1 |
| InChIKey | BKUKZVKMNMVEBB-YADHBBJMSA-N |
| XLogP | 2.15 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|