C22H33N3O — CID 56903434
4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-phenylethyl)piperazin-2-one (PubChem CID 56903434) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is 4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-phenylethyl)piperazin-2-one.
| Compound Name | 4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-phenylethyl)piperazin-2-one |
|---|---|
| PubChem CID | 56903434 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | 4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-phenylethyl)piperazin-2-one |
| SMILES | O=C1CN(C[C@@H]2CCCN3CCCC[C@H]23)CCN1CCc1ccccc1 |
| InChI | InChI=1S/C22H33N3O/c26-22-18-23(15-16-25(22)14-11-19-7-2-1-3-8-19)17-20-9-6-13-24-12-5-4-10-21(20)24/h1-3,7-8,20-21H,4-6,9-18H2/t20-,21+/m0/s1 |
| InChIKey | CWGCBXAELJALHY-LEWJYISDSA-N |
| XLogP | 2.64 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |