C17H24N4O4 — CID 56903983
5-[2-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione (PubChem CID 56903983) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 5-[2-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[2-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56903983 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 5-[2-[(4aS,8aR)-2-oxo-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCCN1C(=O)CC[C@H]2CN(C(=O)Cc3c[nH]c(=O)[nH]c3=O)CC[C@H]21 |
| InChI | InChI=1S/C17H24N4O4/c1-2-6-21-13-5-7-20(10-11(13)3-4-14(21)22)15(23)8-12-9-18-17(25)19-16(12)24/h9,11,13H,2-8,10H2,1H3,(H2,18,19,24,25)/t11-,13+/m0/s1 |
| InChIKey | HQRSRCSXILNYEJ-WCQYABFASA-N |
| XLogP | -0.14 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |