C18H21N5OS — CID 56904015
2-(furan-2-yl)-7-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 56904015) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is 2-(furan-2-yl)-7-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | 2-(furan-2-yl)-7-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 56904015 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-(furan-2-yl)-7-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | Cc1nc(CNc2nc(-c3ccco3)nc3c2CCN(C)CC3)cs1 |
| InChI | InChI=1S/C18H21N5OS/c1-12-20-13(11-25-12)10-19-17-14-5-7-23(2)8-6-15(14)21-18(22-17)16-4-3-9-24-16/h3-4,9,11H,5-8,10H2,1-2H3,(H,19,21,22) |
| InChIKey | IUGIFBUDZHMEEL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |