C16H24N6S — CID 56904387
4-N-methyl-4-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56904387) has the molecular formula C16H24N6S and a molecular weight of 332.48 g/mol. Its IUPAC name is 4-N-methyl-4-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-methyl-4-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56904387 |
| Molecular Formula | C16H24N6S |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 4-N-methyl-4-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | CC(C)c1nc(CN(C)c2nc(N)nc3c2CCNCC3)cs1 |
| InChI | InChI=1S/C16H24N6S/c1-10(2)15-19-11(9-23-15)8-22(3)14-12-4-6-18-7-5-13(12)20-16(17)21-14/h9-10,18H,4-8H2,1-3H3,(H2,17,20,21) |
| InChIKey | KEBZPTSPHYTHPW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |