C17H23N5O3 — CID 56904438
(3aS,6aS)-2-[[2-(ethylamino)pyrimidin-5-yl]methyl]-6-oxo-5-prop-2-enyl-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 56904438) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is (3aS,6aS)-2-[[2-(ethylamino)pyrimidin-5-yl]methyl]-6-oxo-5-prop-2-enyl-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aS)-2-[[2-(ethylamino)pyrimidin-5-yl]methyl]-6-oxo-5-prop-2-enyl-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 56904438 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (3aS,6aS)-2-[[2-(ethylamino)pyrimidin-5-yl]methyl]-6-oxo-5-prop-2-enyl-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | C=CCN1C[C@@]2(C(=O)O)CN(Cc3cnc(NCC)nc3)C[C@H]2C1=O |
| InChI | InChI=1S/C17H23N5O3/c1-3-5-22-11-17(15(24)25)10-21(9-13(17)14(22)23)8-12-6-19-16(18-4-2)20-7-12/h3,6-7,13H,1,4-5,8-11H2,2H3,(H,24,25)(H,18,19,20)/t13-,17-/m0/s1 |
| InChIKey | DELBFDGSFOAOBH-GUYCJALGSA-N |
| XLogP | 0.44 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|