C15H25N3O5S — CID 56904751
2-[4-(dimethylsulfamoyl)morpholin-3-yl]-N-[2-(5-methylfuran-2-yl)ethyl]acetamide (PubChem CID 56904751) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)morpholin-3-yl]-N-[2-(5-methylfuran-2-yl)ethyl]acetamide.
| Compound Name | 2-[4-(dimethylsulfamoyl)morpholin-3-yl]-N-[2-(5-methylfuran-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 56904751 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)morpholin-3-yl]-N-[2-(5-methylfuran-2-yl)ethyl]acetamide |
| SMILES | Cc1ccc(CCNC(=O)CC2COCCN2S(=O)(=O)N(C)C)o1 |
| InChI | InChI=1S/C15H25N3O5S/c1-12-4-5-14(23-12)6-7-16-15(19)10-13-11-22-9-8-18(13)24(20,21)17(2)3/h4-5,13H,6-11H2,1-3H3,(H,16,19) |
| InChIKey | PXRMQQDQBZTNSB-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |