C15H15F2N5O — CID 56904879
N-(4-fluorophenyl)-4-(5-fluoropyrimidin-2-yl)piperazine-2-carboxamide (PubChem CID 56904879) has the molecular formula C15H15F2N5O and a molecular weight of 319.32 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-(5-fluoropyrimidin-2-yl)piperazine-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-(5-fluoropyrimidin-2-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 56904879 |
| Molecular Formula | C15H15F2N5O |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(4-fluorophenyl)-4-(5-fluoropyrimidin-2-yl)piperazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1CN(c2ncc(F)cn2)CCN1 |
| InChI | InChI=1S/C15H15F2N5O/c16-10-1-3-12(4-2-10)21-14(23)13-9-22(6-5-18-13)15-19-7-11(17)8-20-15/h1-4,7-8,13,18H,5-6,9H2,(H,21,23) |
| InChIKey | BYKWPEZLCGYFRI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |