About 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide
2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide (PubChem CID 569050) has the molecular formula C15H12ClF2NO
and a molecular weight of 295.72 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide |
| PubChem CID | 569050 |
| Molecular Formula | C15H12ClF2NO |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H12ClF2NO/c16-12-9-14(18)13(17)8-11(12)15(20)19-7-6-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H,19,20) |
| InChIKey | PUIJETUVCPDBIH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide?
The IUPAC name of 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide (CID 569050) is 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide.
What is the SMILES notation for 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide?
The canonical SMILES for 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide is O=C(NCCc1ccccc1)c1cc(F)c(F)cc1Cl.
What is the InChIKey of 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide?
The InChIKey is PUIJETUVCPDBIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClF2NO/c16-12-9-14(18)13(17)8-11(12)15(20)19-7-6-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H,19,20).
What are the key properties of 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide?
2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide has a molecular weight of 295.72 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,5-difluoro-N-(2-phenylethyl)benzamide is sourced from PubChem (CID 569050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).