C14H18FNO4 — CID 56905075
(3-fluoro-2-methoxyphenyl)-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 56905075) has the molecular formula C14H18FNO4 and a molecular weight of 283.30 g/mol. Its IUPAC name is (3-fluoro-2-methoxyphenyl)-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | (3-fluoro-2-methoxyphenyl)-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 56905075 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (3-fluoro-2-methoxyphenyl)-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | COc1c(F)cccc1C(=O)N1CCCC(O)(CO)C1 |
| InChI | InChI=1S/C14H18FNO4/c1-20-12-10(4-2-5-11(12)15)13(18)16-7-3-6-14(19,8-16)9-17/h2,4-5,17,19H,3,6-9H2,1H3 |
| InChIKey | GADJSZPVUZJSST-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |