C19H24N4O3 — CID 56905457
(4aS,8aR)-1-[2-(1H-imidazol-5-yl)ethyl]-6-(3-methylfuran-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56905457) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(1H-imidazol-5-yl)ethyl]-6-(3-methylfuran-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-[2-(1H-imidazol-5-yl)ethyl]-6-(3-methylfuran-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56905457 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (4aS,8aR)-1-[2-(1H-imidazol-5-yl)ethyl]-6-(3-methylfuran-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | Cc1ccoc1C(=O)N1CC[C@@H]2[C@@H](CCC(=O)N2CCc2cnc[nH]2)C1 |
| InChI | InChI=1S/C19H24N4O3/c1-13-6-9-26-18(13)19(25)22-7-5-16-14(11-22)2-3-17(24)23(16)8-4-15-10-20-12-21-15/h6,9-10,12,14,16H,2-5,7-8,11H2,1H3,(H,20,21)/t14-,16+/m0/s1 |
| InChIKey | GFZYEMVTTAROOC-GOEBONIOSA-N |
| XLogP | 2.01 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |