C15H20N6S — CID 56905485
5-ethyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 56905485) has the molecular formula C15H20N6S and a molecular weight of 316.43 g/mol. Its IUPAC name is 5-ethyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-ethyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 56905485 |
| Molecular Formula | C15H20N6S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 5-ethyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCc1cc(NCCSCc2nc[nH]c2C)n2nccc2n1 |
| InChI | InChI=1S/C15H20N6S/c1-3-12-8-15(21-14(20-12)4-5-19-21)16-6-7-22-9-13-11(2)17-10-18-13/h4-5,8,10,16H,3,6-7,9H2,1-2H3,(H,17,18) |
| InChIKey | MBBYXLOWKAZEJH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|